C16H26FN — CID 63416508
1-(5-fluoro-2-methylphenyl)-N-propylhexan-1-amine (PubChem CID 63416508) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-N-propylhexan-1-amine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 63416508 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-N-propylhexan-1-amine |
| SMILES | CCCCCC(NCCC)c1cc(F)ccc1C |
| InChI | InChI=1S/C16H26FN/c1-4-6-7-8-16(18-11-5-2)15-12-14(17)10-9-13(15)3/h9-10,12,16,18H,4-8,11H2,1-3H3 |
| InChIKey | JNVDORNLLYKQDY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|