C18H26FNO — CID 105129790
1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-N-propylhexan-1-amine (PubChem CID 105129790) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-N-propylhexan-1-amine.
| Compound Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 105129790 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-N-propylhexan-1-amine |
| SMILES | CCCCCC(NCCC)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C18H26FNO/c1-4-6-7-8-16(20-11-5-2)18-13(3)15-12-14(19)9-10-17(15)21-18/h9-10,12,16,20H,4-8,11H2,1-3H3 |
| InChIKey | YMJBSFWPSOZEDH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|