C15H16FNO — CID 105077210
N-ethyl-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)but-3-yn-1-amine (PubChem CID 105077210) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is N-ethyl-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)but-3-yn-1-amine.
| Compound Name | N-ethyl-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 105077210 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-ethyl-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)but-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C15H16FNO/c1-4-6-13(17-5-2)15-10(3)12-9-11(16)7-8-14(12)18-15/h1,7-9,13,17H,5-6H2,2-3H3 |
| InChIKey | BFBYUAKIPYILPN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|