C14H17FO3 — CID 105111899
1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-propoxyethanol (PubChem CID 105111899) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-propoxyethanol.
| Compound Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-propoxyethanol |
|---|---|
| PubChem CID | 105111899 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-propoxyethanol |
| SMILES | CCCOCC(O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C14H17FO3/c1-3-6-17-8-12(16)14-9(2)11-7-10(15)4-5-13(11)18-14/h4-5,7,12,16H,3,6,8H2,1-2H3 |
| InChIKey | WHNCIURCNNTADA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|