C18H17FO2 — CID 105078061
1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-(2-methylphenyl)ethanol (PubChem CID 105078061) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-(2-methylphenyl)ethanol.
| Compound Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-(2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 105078061 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-(2-methylphenyl)ethanol |
| SMILES | Cc1ccccc1CC(O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C18H17FO2/c1-11-5-3-4-6-13(11)9-16(20)18-12(2)15-10-14(19)7-8-17(15)21-18/h3-8,10,16,20H,9H2,1-2H3 |
| InChIKey | FGJLKKRRAAZQGT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |