C16H13ClFNO2 — CID 105105511
2-(3-chloro-4-pyridinyl)-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethanol (PubChem CID 105105511) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-(3-chloro-4-pyridinyl)-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethanol.
| Compound Name | 2-(3-chloro-4-pyridinyl)-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethanol |
|---|---|
| PubChem CID | 105105511 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-(3-chloro-4-pyridinyl)-1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethanol |
| SMILES | Cc1c(C(O)Cc2ccncc2Cl)oc2ccc(F)cc12 |
| InChI | InChI=1S/C16H13ClFNO2/c1-9-12-7-11(18)2-3-15(12)21-16(9)14(20)6-10-4-5-19-8-13(10)17/h2-5,7-8,14,20H,6H2,1H3 |
| InChIKey | ZIODAUUUSITWIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |