C13H9Cl2F2NO — CID 112655781
1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanol (PubChem CID 112655781) has the molecular formula C13H9Cl2F2NO and a molecular weight of 304.12 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanol |
|---|---|
| PubChem CID | 112655781 |
| Molecular Formula | C13H9Cl2F2NO |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanol |
| SMILES | OC(Cc1ccncc1Cl)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H9Cl2F2NO/c14-9-5-11(16)8(4-12(9)17)13(19)3-7-1-2-18-6-10(7)15/h1-2,4-6,13,19H,3H2 |
| InChIKey | JCPZHTQVYQPTMZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|