C12H11ClF2N2O — CID 115780481
1-(4-chloro-2,5-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol (PubChem CID 115780481) has the molecular formula C12H11ClF2N2O and a molecular weight of 272.68 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 115780481 |
| Molecular Formula | C12H11ClF2N2O |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2cc(F)c(Cl)cc2F)cn1 |
| InChI | InChI=1S/C12H11ClF2N2O/c1-17-6-7(5-16-17)2-12(18)8-3-11(15)9(13)4-10(8)14/h3-6,12,18H,2H2,1H3 |
| InChIKey | VZTNMMRGNHRRGU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|