C8H14N2O2 — CID 79450253
2-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diol (PubChem CID 79450253) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79450253 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diol |
| SMILES | Cn1cc(CC(CO)CO)cn1 |
| InChI | InChI=1S/C8H14N2O2/c1-10-4-7(3-9-10)2-8(5-11)6-12/h3-4,8,11-12H,2,5-6H2,1H3 |
| InChIKey | PELOWAXIRDZOLM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |