C12H9F5N2O — CID 115780286
2-(1-methylpyrazol-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanol (PubChem CID 115780286) has the molecular formula C12H9F5N2O and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanol.
| Compound Name | 2-(1-methylpyrazol-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
|---|---|
| PubChem CID | 115780286 |
| Molecular Formula | C12H9F5N2O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
| SMILES | Cn1cc(CC(O)c2c(F)c(F)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C12H9F5N2O/c1-19-4-5(3-18-19)2-6(20)7-8(13)10(15)12(17)11(16)9(7)14/h3-4,6,20H,2H2,1H3 |
| InChIKey | JDDBPEANOAHPRN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|