C7H11F2N3 — CID 103516463
1,1-difluoro-3-(1-methylpyrazol-4-yl)propan-2-amine (PubChem CID 103516463) has the molecular formula C7H11F2N3 and a molecular weight of 175.18 g/mol. Its IUPAC name is 1,1-difluoro-3-(1-methylpyrazol-4-yl)propan-2-amine.
| Compound Name | 1,1-difluoro-3-(1-methylpyrazol-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 103516463 |
| Molecular Formula | C7H11F2N3 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1,1-difluoro-3-(1-methylpyrazol-4-yl)propan-2-amine |
| SMILES | Cn1cc(CC(N)C(F)F)cn1 |
| InChI | InChI=1S/C7H11F2N3/c1-12-4-5(3-11-12)2-6(10)7(8)9/h3-4,6-7H,2,10H2,1H3 |
| InChIKey | ZORNAIGLZSKHMV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |