C9H14F3N3 — CID 79954244
5,5,5-trifluoro-1-(1-methylpyrazol-4-yl)pentan-2-amine (PubChem CID 79954244) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(1-methylpyrazol-4-yl)pentan-2-amine.
| Compound Name | 5,5,5-trifluoro-1-(1-methylpyrazol-4-yl)pentan-2-amine |
|---|---|
| PubChem CID | 79954244 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5,5,5-trifluoro-1-(1-methylpyrazol-4-yl)pentan-2-amine |
| SMILES | Cn1cc(CC(N)CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H14F3N3/c1-15-6-7(5-14-15)4-8(13)2-3-9(10,11)12/h5-6,8H,2-4,13H2,1H3 |
| InChIKey | RFVJIQWFYOBPQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |