C9H17N3O2 — CID 79492316
1,1-dimethoxy-3-(1-methylpyrazol-4-yl)propan-2-amine (PubChem CID 79492316) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1,1-dimethoxy-3-(1-methylpyrazol-4-yl)propan-2-amine.
| Compound Name | 1,1-dimethoxy-3-(1-methylpyrazol-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 79492316 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1,1-dimethoxy-3-(1-methylpyrazol-4-yl)propan-2-amine |
| SMILES | COC(OC)C(N)Cc1cnn(C)c1 |
| InChI | InChI=1S/C9H17N3O2/c1-12-6-7(5-11-12)4-8(10)9(13-2)14-3/h5-6,8-9H,4,10H2,1-3H3 |
| InChIKey | PGKBXSQHWQRSTB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|