C11H18F3N3 — CID 113327318
1-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]butan-2-amine (PubChem CID 113327318) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]butan-2-amine.
| Compound Name | 1-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]butan-2-amine |
|---|---|
| PubChem CID | 113327318 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]butan-2-amine |
| SMILES | CCC(N)Cc1cnn(CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H18F3N3/c1-2-10(15)6-9-7-16-17(8-9)5-3-4-11(12,13)14/h7-8,10H,2-6,15H2,1H3 |
| InChIKey | UGLFORBPQWKKAX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |