C12H12BrFN2O — CID 115780374
1-(2-bromo-4-fluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol (PubChem CID 115780374) has the molecular formula C12H12BrFN2O and a molecular weight of 299.14 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 115780374 |
| Molecular Formula | C12H12BrFN2O |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2ccc(F)cc2Br)cn1 |
| InChI | InChI=1S/C12H12BrFN2O/c1-16-7-8(6-15-16)4-12(17)10-3-2-9(14)5-11(10)13/h2-3,5-7,12,17H,4H2,1H3 |
| InChIKey | ZSZTYQZELBWJAV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |