C14H17BrFN3 — CID 103778176
1-(2-bromo-4-fluorophenyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine (PubChem CID 103778176) has the molecular formula C14H17BrFN3 and a molecular weight of 326.21 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 103778176 |
| Molecular Formula | C14H17BrFN3 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1cnn(C)c1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H17BrFN3/c1-10(13-4-3-12(16)7-14(13)15)17-6-5-11-8-18-19(2)9-11/h3-4,7-10,17H,5-6H2,1-2H3 |
| InChIKey | MJSHUWPNWVOEHL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |