C15H13BrF2O — CID 105377660
1-(2-bromo-4-fluorophenyl)-2-(5-fluoro-2-methylphenyl)ethanol (PubChem CID 105377660) has the molecular formula C15H13BrF2O and a molecular weight of 327.17 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-2-(5-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-2-(5-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 105377660 |
| Molecular Formula | C15H13BrF2O |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-2-(5-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1ccc(F)cc1CC(O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H13BrF2O/c1-9-2-3-11(17)6-10(9)7-15(19)13-5-4-12(18)8-14(13)16/h2-6,8,15,19H,7H2,1H3 |
| InChIKey | NJKIPRAINOFKCR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |