C14H14BrFOS — CID 102829639
1-(4-bromo-5-methylthiophen-2-yl)-2-(5-fluoro-2-methylphenyl)ethanol (PubChem CID 102829639) has the molecular formula C14H14BrFOS and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-2-(5-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-(5-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 102829639 |
| Molecular Formula | C14H14BrFOS |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-(5-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1ccc(F)cc1CC(O)c1cc(Br)c(C)s1 |
| InChI | InChI=1S/C14H14BrFOS/c1-8-3-4-11(16)5-10(8)6-13(17)14-7-12(15)9(2)18-14/h3-5,7,13,17H,6H2,1-2H3 |
| InChIKey | PJVBKAOFJAFSCX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |