C14H12BrF3OS — CID 102829532
1-(4-bromo-5-methylthiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 102829532) has the molecular formula C14H12BrF3OS and a molecular weight of 365.21 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 102829532 |
| Molecular Formula | C14H12BrF3OS |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1sc(C(O)Cc2ccc(C(F)(F)F)cc2)cc1Br |
| InChI | InChI=1S/C14H12BrF3OS/c1-8-11(15)7-13(20-8)12(19)6-9-2-4-10(5-3-9)14(16,17)18/h2-5,7,12,19H,6H2,1H3 |
| InChIKey | CITUEWYPIQTJMZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |