C16H18BrClOS — CID 102830173
1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-tert-butylphenyl)ethanol (PubChem CID 102830173) has the molecular formula C16H18BrClOS and a molecular weight of 373.74 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-tert-butylphenyl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-tert-butylphenyl)ethanol |
|---|---|
| PubChem CID | 102830173 |
| Molecular Formula | C16H18BrClOS |
| Molecular Weight | 373.74 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-tert-butylphenyl)ethanol |
| SMILES | CC(C)(C)c1ccc(CC(O)c2cc(Br)c(Cl)s2)cc1 |
| InChI | InChI=1S/C16H18BrClOS/c1-16(2,3)11-6-4-10(5-7-11)8-13(19)14-9-12(17)15(18)20-14/h4-7,9,13,19H,8H2,1-3H3 |
| InChIKey | MJDDSQHRDMOEEF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |