C14H14BrClOS — CID 102829878
1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-ethylphenyl)ethanol (PubChem CID 102829878) has the molecular formula C14H14BrClOS and a molecular weight of 345.69 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-ethylphenyl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 102829878 |
| Molecular Formula | C14H14BrClOS |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-ethylphenyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(Br)c(Cl)s2)cc1 |
| InChI | InChI=1S/C14H14BrClOS/c1-2-9-3-5-10(6-4-9)7-12(17)13-8-11(15)14(16)18-13/h3-6,8,12,17H,2,7H2,1H3 |
| InChIKey | OVUUCQXBNATBCG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |