C12H9Br2ClOS — CID 102830220
1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-bromophenyl)ethanol (PubChem CID 102830220) has the molecular formula C12H9Br2ClOS and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-bromophenyl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-bromophenyl)ethanol |
|---|---|
| PubChem CID | 102830220 |
| Molecular Formula | C12H9Br2ClOS |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 393.84 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(4-bromophenyl)ethanol |
| SMILES | OC(Cc1ccc(Br)cc1)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H9Br2ClOS/c13-8-3-1-7(2-4-8)5-10(16)11-6-9(14)12(15)17-11/h1-4,6,10,16H,5H2 |
| InChIKey | NWIPFOSWFDADOJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |