C13H16BrClN2OS — CID 102830097
1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-butan-2-ylpyrazol-3-yl)ethanol (PubChem CID 102830097) has the molecular formula C13H16BrClN2OS and a molecular weight of 363.71 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-butan-2-ylpyrazol-3-yl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-butan-2-ylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 102830097 |
| Molecular Formula | C13H16BrClN2OS |
| Molecular Weight | 363.71 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-butan-2-ylpyrazol-3-yl)ethanol |
| SMILES | CCC(C)n1ccc(CC(O)c2cc(Br)c(Cl)s2)n1 |
| InChI | InChI=1S/C13H16BrClN2OS/c1-3-8(2)17-5-4-9(16-17)6-11(18)12-7-10(14)13(15)19-12/h4-5,7-8,11,18H,3,6H2,1-2H3 |
| InChIKey | NTXRXMHVKROEIR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |