C17H22O2S — CID 115786578
2-(4-tert-butylphenyl)-1-(4-methoxythiophen-2-yl)ethanol (PubChem CID 115786578) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-(4-methoxythiophen-2-yl)ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-1-(4-methoxythiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 115786578 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-(4-methoxythiophen-2-yl)ethanol |
| SMILES | COc1csc(C(O)Cc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C17H22O2S/c1-17(2,3)13-7-5-12(6-8-13)9-15(18)16-10-14(19-4)11-20-16/h5-8,10-11,15,18H,9H2,1-4H3 |
| InChIKey | KZGJILQIZMLSOI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |