C13H10BrF3OS — CID 62116122
1-(5-bromothiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 62116122) has the molecular formula C13H10BrF3OS and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 62116122 |
| Molecular Formula | C13H10BrF3OS |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(Cc1ccc(C(F)(F)F)cc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H10BrF3OS/c14-12-6-5-11(19-12)10(18)7-8-1-3-9(4-2-8)13(15,16)17/h1-6,10,18H,7H2 |
| InChIKey | XAVUGWBDDBMNTD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |