C12H9BrF3NOS — CID 105087304
2-(5-bromothiophen-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol (PubChem CID 105087304) has the molecular formula C12H9BrF3NOS and a molecular weight of 352.18 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 105087304 |
| Molecular Formula | C12H9BrF3NOS |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
| SMILES | OC(Cc1ccc(Br)s1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H9BrF3NOS/c13-11-4-2-8(19-11)5-10(18)9-3-1-7(6-17-9)12(14,15)16/h1-4,6,10,18H,5H2 |
| InChIKey | LOHNKDLJPOGBRO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |