C14H10Cl2F3NO — CID 105086791
2-(2,4-dichlorophenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol (PubChem CID 105086791) has the molecular formula C14H10Cl2F3NO and a molecular weight of 336.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 105086791 |
| Molecular Formula | C14H10Cl2F3NO |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H10Cl2F3NO/c15-10-3-1-8(11(16)6-10)5-13(21)12-4-2-9(7-20-12)14(17,18)19/h1-4,6-7,13,21H,5H2 |
| InChIKey | OEFRQWGKBBPZAW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |