C15H13ClF3NO — CID 106867992
2-(2-chloro-4-methylphenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol (PubChem CID 106867992) has the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 106867992 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
| SMILES | Cc1ccc(CC(O)c2ccc(C(F)(F)F)cn2)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClF3NO/c1-9-2-3-10(12(16)6-9)7-14(21)13-5-4-11(8-20-13)15(17,18)19/h2-6,8,14,21H,7H2,1H3 |
| InChIKey | WBSZARPRXGQHBK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |