C11H12ClF3O — CID 106867273
1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-ol (PubChem CID 106867273) has the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 106867273 |
| Molecular Formula | C11H12ClF3O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-ol |
| SMILES | Cc1ccc(CC(O)CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClF3O/c1-7-2-3-8(10(12)4-7)5-9(16)6-11(13,14)15/h2-4,9,16H,5-6H2,1H3 |
| InChIKey | UCMIYHHHJPRQKK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |