C17H27ClO — CID 106868167
1-(2-chloro-4-methylphenyl)-4,6,6-trimethylheptan-2-ol (PubChem CID 106868167) has the molecular formula C17H27ClO and a molecular weight of 282.86 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-4,6,6-trimethylheptan-2-ol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-4,6,6-trimethylheptan-2-ol |
|---|---|
| PubChem CID | 106868167 |
| Molecular Formula | C17H27ClO |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-4,6,6-trimethylheptan-2-ol |
| SMILES | Cc1ccc(CC(O)CC(C)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H27ClO/c1-12-6-7-14(16(18)9-12)10-15(19)8-13(2)11-17(3,4)5/h6-7,9,13,15,19H,8,10-11H2,1-5H3 |
| InChIKey | SMTNYRFTQHWUKJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |