C13H19ClO2 — CID 106867632
1-(2-chloro-4-methylphenyl)-3-methylpentane-2,3-diol (PubChem CID 106867632) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-methylpentane-2,3-diol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-methylpentane-2,3-diol |
|---|---|
| PubChem CID | 106867632 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-methylpentane-2,3-diol |
| SMILES | CCC(C)(O)C(O)Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H19ClO2/c1-4-13(3,16)12(15)8-10-6-5-9(2)7-11(10)14/h5-7,12,15-16H,4,8H2,1-3H3 |
| InChIKey | DZBUCJIHXVMDDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |