C15H23ClO2 — CID 106867588
1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxypentan-2-ol (PubChem CID 106867588) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxypentan-2-ol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxypentan-2-ol |
|---|---|
| PubChem CID | 106867588 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxypentan-2-ol |
| SMILES | CCC(CC)(OC)C(O)Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C15H23ClO2/c1-5-15(6-2,18-4)14(17)10-12-8-7-11(3)9-13(12)16/h7-9,14,17H,5-6,10H2,1-4H3 |
| InChIKey | ZMKBVAXEJBZXCB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |