C18H30ClNO — CID 106868842
1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxy-N-propylpentan-2-amine (PubChem CID 106868842) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxy-N-propylpentan-2-amine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxy-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 106868842 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-ethyl-3-methoxy-N-propylpentan-2-amine |
| SMILES | CCCNC(Cc1ccc(C)cc1Cl)C(CC)(CC)OC |
| InChI | InChI=1S/C18H30ClNO/c1-6-11-20-17(18(7-2,8-3)21-5)13-15-10-9-14(4)12-16(15)19/h9-10,12,17,20H,6-8,11,13H2,1-5H3 |
| InChIKey | PUDJHZCYAKOKQL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |