C13H19ClO2 — CID 106867286
1-(2-chloro-4-methylphenyl)-3-propoxypropan-2-ol (PubChem CID 106867286) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-propoxypropan-2-ol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-propoxypropan-2-ol |
|---|---|
| PubChem CID | 106867286 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-propoxypropan-2-ol |
| SMILES | CCCOCC(O)Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H19ClO2/c1-3-6-16-9-12(15)8-11-5-4-10(2)7-13(11)14/h4-5,7,12,15H,3,6,8-9H2,1-2H3 |
| InChIKey | IDYPUXUQIVTBTO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|