C14H22ClN — CID 106866597
1-(2-chloro-4-methylphenyl)-3,3-dimethylpentan-2-amine (PubChem CID 106866597) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3,3-dimethylpentan-2-amine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 106866597 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3,3-dimethylpentan-2-amine |
| SMILES | CCC(C)(C)C(N)Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C14H22ClN/c1-5-14(3,4)13(16)9-11-7-6-10(2)8-12(11)15/h6-8,13H,5,9,16H2,1-4H3 |
| InChIKey | TYGQVDFYXLMQCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |