C11H13ClF3N — CID 106867257
1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-amine (PubChem CID 106867257) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-amine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 106867257 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-4,4,4-trifluorobutan-2-amine |
| SMILES | Cc1ccc(CC(N)CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClF3N/c1-7-2-3-8(10(12)4-7)5-9(16)6-11(13,14)15/h2-4,9H,5-6,16H2,1H3 |
| InChIKey | BEWZELIKERMXSX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |