C15H13ClF3N — CID 106866965
2-(2-chloro-4-methylphenyl)-1-(2,4,6-trifluorophenyl)ethanamine (PubChem CID 106866965) has the molecular formula C15H13ClF3N and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-(2,4,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 106866965 |
| Molecular Formula | C15H13ClF3N |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2c(F)cc(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClF3N/c1-8-2-3-9(11(16)4-8)5-14(20)15-12(18)6-10(17)7-13(15)19/h2-4,6-7,14H,5,20H2,1H3 |
| InChIKey | NYLWGGMQNMTUQL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |