C15H13BrClF2N — CID 107538663
1-(2-bromo-3,4-difluorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine (PubChem CID 107538663) has the molecular formula C15H13BrClF2N and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 107538663 |
| Molecular Formula | C15H13BrClF2N |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2ccc(F)c(F)c2Br)c(Cl)c1 |
| InChI | InChI=1S/C15H13BrClF2N/c1-8-2-3-9(11(17)6-8)7-13(20)10-4-5-12(18)15(19)14(10)16/h2-6,13H,7,20H2,1H3 |
| InChIKey | ILJFOSNJDVYOOO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|