C15H14BrCl2N — CID 106867036
1-(4-bromo-2-chlorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine (PubChem CID 106867036) has the molecular formula C15H14BrCl2N and a molecular weight of 359.09 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 106867036 |
| Molecular Formula | C15H14BrCl2N |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2ccc(Br)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2N/c1-9-2-3-10(13(17)6-9)7-15(19)12-5-4-11(16)8-14(12)18/h2-6,8,15H,7,19H2,1H3 |
| InChIKey | LREOZQZCRVDOJU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |