C16H17Cl2N — CID 106866364
1-(2-chloro-3-methylphenyl)-2-(2-chloro-4-methylphenyl)ethanamine (PubChem CID 106866364) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 1-(2-chloro-3-methylphenyl)-2-(2-chloro-4-methylphenyl)ethanamine.
| Compound Name | 1-(2-chloro-3-methylphenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 106866364 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(2-chloro-3-methylphenyl)-2-(2-chloro-4-methylphenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2cccc(C)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N/c1-10-6-7-12(14(17)8-10)9-15(19)13-5-3-4-11(2)16(13)18/h3-8,15H,9,19H2,1-2H3 |
| InChIKey | FGEYECOJUAHCPP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |