C15H14Br2ClNO — CID 115817163
1-(4-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethanamine (PubChem CID 115817163) has the molecular formula C15H14Br2ClNO and a molecular weight of 419.54 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115817163 |
| Molecular Formula | C15H14Br2ClNO |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 416.91 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(Br)cc1CC(N)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H14Br2ClNO/c1-20-15-5-3-10(16)6-9(15)7-14(19)12-4-2-11(17)8-13(12)18/h2-6,8,14H,7,19H2,1H3 |
| InChIKey | VACRWFCNYWUTPK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |