C13H20ClN — CID 106870188
5-(2-chloro-4-methylphenyl)-4-methylpentan-2-amine (PubChem CID 106870188) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 5-(2-chloro-4-methylphenyl)-4-methylpentan-2-amine.
| Compound Name | 5-(2-chloro-4-methylphenyl)-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 106870188 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-(2-chloro-4-methylphenyl)-4-methylpentan-2-amine |
| SMILES | Cc1ccc(CC(C)CC(C)N)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-9-4-5-12(13(14)8-9)7-10(2)6-11(3)15/h4-5,8,10-11H,6-7,15H2,1-3H3 |
| InChIKey | GSZDRQBOBBVUFW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |