C10H10ClF3O — CID 106867561
(2R)-3-(2-chloro-4-methylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 106867561) has the molecular formula C10H10ClF3O and a molecular weight of 238.64 g/mol. Its IUPAC name is (2R)-3-(2-chloro-4-methylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-(2-chloro-4-methylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 106867561 |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (2R)-3-(2-chloro-4-methylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1ccc(C[C@@H](O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClF3O/c1-6-2-3-7(8(11)4-6)5-9(15)10(12,13)14/h2-4,9,15H,5H2,1H3/t9-/m1/s1 |
| InChIKey | LKBZNINLDPSDNP-SECBINFHSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |