C9H7Cl2F3O — CID 62963527
3-(2,4-dichlorophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 62963527) has the molecular formula C9H7Cl2F3O and a molecular weight of 259.05 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(2,4-dichlorophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 62963527 |
| Molecular Formula | C9H7Cl2F3O |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F3O/c10-6-2-1-5(7(11)4-6)3-8(15)9(12,13)14/h1-2,4,8,15H,3H2 |
| InChIKey | HXYZWRAQULSLNA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |