C11H16Cl2O2 — CID 144705825
1-(2,4-dichlorophenyl)butan-2-ol;methanol (PubChem CID 144705825) has the molecular formula C11H16Cl2O2 and a molecular weight of 251.15 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)butan-2-ol;methanol.
| Compound Name | 1-(2,4-dichlorophenyl)butan-2-ol;methanol |
|---|---|
| PubChem CID | 144705825 |
| Molecular Formula | C11H16Cl2O2 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)butan-2-ol;methanol |
| SMILES | CCC(O)Cc1ccc(Cl)cc1Cl.CO |
| InChI | InChI=1S/C10H12Cl2O.CH4O/c1-2-9(13)5-7-3-4-8(11)6-10(7)12;1-2/h3-4,6,9,13H,2,5H2,1H3;2H,1H3 |
| InChIKey | KRICMPSRNQVQBL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |