C16H24Cl2O — CID 63410443
1-(2,4-dichlorophenyl)-4-ethyloctan-2-ol (PubChem CID 63410443) has the molecular formula C16H24Cl2O and a molecular weight of 303.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-ethyloctan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-4-ethyloctan-2-ol |
|---|---|
| PubChem CID | 63410443 |
| Molecular Formula | C16H24Cl2O |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-ethyloctan-2-ol |
| SMILES | CCCCC(CC)CC(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2O/c1-3-5-6-12(4-2)9-15(19)10-13-7-8-14(17)11-16(13)18/h7-8,11-12,15,19H,3-6,9-10H2,1-2H3 |
| InChIKey | SRQMYVONEIWKRJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |