C19H32Cl2P+ — CID 8287
tributyl-[(2,4-dichlorophenyl)methyl]phosphanium (PubChem CID 8287) has the molecular formula C19H32Cl2P+ and a molecular weight of 362.35 g/mol. Its IUPAC name is tributyl-[(2,4-dichlorophenyl)methyl]phosphanium.
| Compound Name | tributyl-[(2,4-dichlorophenyl)methyl]phosphanium |
|---|---|
| PubChem CID | 8287 |
| Molecular Formula | C19H32Cl2P+ |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tributyl-[(2,4-dichlorophenyl)methyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H32Cl2P/c1-4-7-12-22(13-8-5-2,14-9-6-3)16-17-10-11-18(20)15-19(17)21/h10-11,15H,4-9,12-14,16H2,1-3H3/q+1 |
| InChIKey | OAGIOQZKOZPWKF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|