C14H21Cl2N — CID 55196979
2-[(2,4-dichlorophenyl)methyl]-N-ethylpentan-1-amine (PubChem CID 55196979) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-N-ethylpentan-1-amine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-N-ethylpentan-1-amine |
|---|---|
| PubChem CID | 55196979 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-N-ethylpentan-1-amine |
| SMILES | CCCC(CNCC)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N/c1-3-5-11(10-17-4-2)8-12-6-7-13(15)9-14(12)16/h6-7,9,11,17H,3-5,8,10H2,1-2H3 |
| InChIKey | CEKXSZUAKZPRNY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |