C20H28O — CID 105080592
4-ethyl-1-naphthalen-2-yloctan-2-ol (PubChem CID 105080592) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 4-ethyl-1-naphthalen-2-yloctan-2-ol.
| Compound Name | 4-ethyl-1-naphthalen-2-yloctan-2-ol |
|---|---|
| PubChem CID | 105080592 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 4-ethyl-1-naphthalen-2-yloctan-2-ol |
| SMILES | CCCCC(CC)CC(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H28O/c1-3-5-8-16(4-2)14-20(21)15-17-11-12-18-9-6-7-10-19(18)13-17/h6-7,9-13,16,20-21H,3-5,8,14-15H2,1-2H3 |
| InChIKey | LSNXYSMLPMRELS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |