C18H30O — CID 114981430
1-(2,5-dimethylphenyl)-4-ethyloctan-2-ol (PubChem CID 114981430) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-ethyloctan-2-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-4-ethyloctan-2-ol |
|---|---|
| PubChem CID | 114981430 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-ethyloctan-2-ol |
| SMILES | CCCCC(CC)CC(O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C18H30O/c1-5-7-8-16(6-2)12-18(19)13-17-11-14(3)9-10-15(17)4/h9-11,16,18-19H,5-8,12-13H2,1-4H3 |
| InChIKey | AYMJTGBBOADNTM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |